C27H33FN4O2S — CID 3171981
1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3171981) has the molecular formula C27H33FN4O2S and a molecular weight of 496.65 g/mol. Its IUPAC name is 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3171981 |
| Molecular Formula | C27H33FN4O2S |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc2cc(CN(Cc3ccc(F)cc3)C(=S)NCCCN3CCOCC3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C27H33FN4O2S/c1-19-14-22-16-23(26(33)30-25(22)15-20(19)2)18-32(17-21-4-6-24(28)7-5-21)27(35)29-8-3-9-31-10-12-34-13-11-31/h4-7,14-16H,3,8-13,17-18H2,1-2H3,(H,29,35)(H,30,33) |
| InChIKey | SEAVJERNYIFYMZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|