C26H29ClN4O4S — CID 3184545
1-[(4-chlorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea (PubChem CID 3184545) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3184545 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(3-morpholin-4-ylpropyl)-1-[(6-oxo-5H-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]thiourea |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1ccc(Cl)cc1)C(=S)NCCCN1CCOCC1)OCO3 |
| InChI | InChI=1S/C26H29ClN4O4S/c27-21-4-2-18(3-5-21)15-31(26(36)28-6-1-7-30-8-10-33-11-9-30)16-20-12-19-13-23-24(35-17-34-23)14-22(19)29-25(20)32/h2-5,12-14H,1,6-11,15-17H2,(H,28,36)(H,29,32) |
| InChIKey | QUTIBQUBOZDSFG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|