C25H36ClN5O3S — CID 3170909
1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3170909) has the molecular formula C25H36ClN5O3S and a molecular weight of 522.12 g/mol. Its IUPAC name is 1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3170909 |
| Molecular Formula | C25H36ClN5O3S |
| Molecular Weight | 522.12 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc2cc(CN(CCN3CCOCC3)C(=S)NCCCN3CCOCC3)c(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C25H36ClN5O3S/c1-19-15-20-16-21(24(32)28-23(20)17-22(19)26)18-31(6-5-30-9-13-34-14-10-30)25(35)27-3-2-4-29-7-11-33-12-8-29/h15-17H,2-14,18H2,1H3,(H,27,35)(H,28,32) |
| InChIKey | HFBSWTCNAISHNG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|