C24H37N3OS — CID 4069593
3-[2-(cyclohexen-1-yl)ethyl]-1-[(4-methylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4069593) has the molecular formula C24H37N3OS and a molecular weight of 415.65 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-1-[(4-methylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-1-[(4-methylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4069593 |
| Molecular Formula | C24H37N3OS |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-1-[(4-methylphenyl)methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(CN(CCCN2CCOCC2)C(=S)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C24H37N3OS/c1-21-8-10-23(11-9-21)20-27(15-5-14-26-16-18-28-19-17-26)24(29)25-13-12-22-6-3-2-4-7-22/h6,8-11H,2-5,7,12-20H2,1H3,(H,25,29) |
| InChIKey | MPACSGDIYIILOK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|