C23H36N4O2S2 — CID 46504172
N-[2-(cyclohexen-1-yl)ethyl]-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide (PubChem CID 46504172) has the molecular formula C23H36N4O2S2 and a molecular weight of 464.70 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide |
|---|---|
| PubChem CID | 46504172 |
| Molecular Formula | C23H36N4O2S2 |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide |
| SMILES | O=C(CNC(=S)N(CCCN1CCOCC1)Cc1cccs1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H36N4O2S2/c28-22(24-10-9-20-6-2-1-3-7-20)18-25-23(30)27(19-21-8-4-17-31-21)12-5-11-26-13-15-29-16-14-26/h4,6,8,17H,1-3,5,7,9-16,18-19H2,(H,24,28)(H,25,30) |
| InChIKey | VTMMOHPCKAVDJB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|