C20H32N4O3S2 — CID 46504165
2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 46504165) has the molecular formula C20H32N4O3S2 and a molecular weight of 440.64 g/mol. Its IUPAC name is 2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46504165 |
| Molecular Formula | C20H32N4O3S2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC(=S)N(CCCN1CCOCC1)Cc1cccs1)NCC1CCCO1 |
| InChI | InChI=1S/C20H32N4O3S2/c25-19(21-14-17-4-1-10-27-17)15-22-20(28)24(16-18-5-2-13-29-18)7-3-6-23-8-11-26-12-9-23/h2,5,13,17H,1,3-4,6-12,14-16H2,(H,21,25)(H,22,28) |
| InChIKey | WJSUHRMPRTXFGA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|