C21H36N4O2S2 — CID 46504175
N-butyl-N-ethyl-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide (PubChem CID 46504175) has the molecular formula C21H36N4O2S2 and a molecular weight of 440.68 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide.
| Compound Name | N-butyl-N-ethyl-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide |
|---|---|
| PubChem CID | 46504175 |
| Molecular Formula | C21H36N4O2S2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-butyl-N-ethyl-2-[[3-morpholin-4-ylpropyl(thiophen-2-ylmethyl)carbamothioyl]amino]acetamide |
| SMILES | CCCCN(CC)C(=O)CNC(=S)N(CCCN1CCOCC1)Cc1cccs1 |
| InChI | InChI=1S/C21H36N4O2S2/c1-3-5-10-24(4-2)20(26)17-22-21(28)25(18-19-8-6-16-29-19)11-7-9-23-12-14-27-15-13-23/h6,8,16H,3-5,7,9-15,17-18H2,1-2H3,(H,22,28) |
| InChIKey | GWIRLCUHSQXGCC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|