C20H27N3S2 — CID 4152505
3-(2-methylphenyl)-1-(3-pyrrolidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4152505) has the molecular formula C20H27N3S2 and a molecular weight of 373.59 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1-(3-pyrrolidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(2-methylphenyl)-1-(3-pyrrolidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4152505 |
| Molecular Formula | C20H27N3S2 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-(2-methylphenyl)-1-(3-pyrrolidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N(CCCN1CCCC1)Cc1cccs1 |
| InChI | InChI=1S/C20H27N3S2/c1-17-8-2-3-10-19(17)21-20(24)23(16-18-9-6-15-25-18)14-7-13-22-11-4-5-12-22/h2-3,6,8-10,15H,4-5,7,11-14,16H2,1H3,(H,21,24) |
| InChIKey | AGAMPDNVFQXXLN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|