C22H31N3S2 — CID 4086716
3-(2-ethylphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4086716) has the molecular formula C22H31N3S2 and a molecular weight of 401.65 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4086716 |
| Molecular Formula | C22H31N3S2 |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-(2-ethylphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCCN1CCCCC1)Cc1cccs1 |
| InChI | InChI=1S/C22H31N3S2/c1-2-19-10-4-5-12-21(19)23-22(26)25(18-20-11-8-17-27-20)16-9-15-24-13-6-3-7-14-24/h4-5,8,10-12,17H,2-3,6-7,9,13-16,18H2,1H3,(H,23,26) |
| InChIKey | JXTDASCOABVZKU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|