C23H33ClN4OS2 — CID 46504238
3-(4-chloro-2-methoxy-5-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 46504238) has the molecular formula C23H33ClN4OS2 and a molecular weight of 481.13 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-5-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 46504238 |
| Molecular Formula | C23H33ClN4OS2 |
| Molecular Weight | 481.13 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN1CCN(CCCN(Cc2cccs2)C(=S)Nc2cc(C)c(Cl)cc2OC)CC1 |
| InChI | InChI=1S/C23H33ClN4OS2/c1-4-26-10-12-27(13-11-26)8-6-9-28(17-19-7-5-14-31-19)23(30)25-21-15-18(2)20(24)16-22(21)29-3/h5,7,14-16H,4,6,8-13,17H2,1-3H3,(H,25,30) |
| InChIKey | SBCHZGSEWZBTSD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.13 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|