C22H31ClN4OS — CID 4066551
3-(4-chloro-3-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(furan-2-ylmethyl)thiourea (PubChem CID 4066551) has the molecular formula C22H31ClN4OS and a molecular weight of 435.04 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-3-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4066551 |
| Molecular Formula | C22H31ClN4OS |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 3-(4-chloro-3-methylphenyl)-1-[3-(4-ethylpiperazin-1-yl)propyl]-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCN1CCN(CCCN(Cc2ccco2)C(=S)Nc2ccc(Cl)c(C)c2)CC1 |
| InChI | InChI=1S/C22H31ClN4OS/c1-3-25-11-13-26(14-12-25)9-5-10-27(17-20-6-4-15-28-20)22(29)24-19-7-8-21(23)18(2)16-19/h4,6-8,15-16H,3,5,9-14,17H2,1-2H3,(H,24,29) |
| InChIKey | KPDMFZRLKDIHQL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|