C20H23ClF3N3O2S — CID 23095614
3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 23095614) has the molecular formula C20H23ClF3N3O2S and a molecular weight of 461.94 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 23095614 |
| Molecular Formula | C20H23ClF3N3O2S |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)N(CCCN2CCOCC2)Cc2ccco2)c1 |
| InChI | InChI=1S/C20H23ClF3N3O2S/c21-17-5-4-15(20(22,23)24)13-18(17)25-19(30)27(14-16-3-1-10-29-16)7-2-6-26-8-11-28-12-9-26/h1,3-5,10,13H,2,6-9,11-12,14H2,(H,25,30) |
| InChIKey | YLKFULDIAKFUEI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|