C22H25ClF3N3OS — CID 4245013
1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 4245013) has the molecular formula C22H25ClF3N3OS and a molecular weight of 471.98 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 4245013 |
| Molecular Formula | C22H25ClF3N3OS |
| Molecular Weight | 471.98 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)N(CCCN2CCOCC2)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H25ClF3N3OS/c23-19-7-5-17(6-8-19)16-29(10-2-9-28-11-13-30-14-12-28)21(31)27-20-4-1-3-18(15-20)22(24,25)26/h1,3-8,15H,2,9-14,16H2,(H,27,31) |
| InChIKey | CYEJOMUFGWCKFP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|