C20H22ClF3N4OS — CID 4548471
3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4548471) has the molecular formula C20H22ClF3N4OS and a molecular weight of 458.94 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4548471 |
| Molecular Formula | C20H22ClF3N4OS |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)N(CCN2CCOCC2)Cc2cccnc2)c1 |
| InChI | InChI=1S/C20H22ClF3N4OS/c21-17-4-3-16(20(22,23)24)12-18(17)26-19(30)28(14-15-2-1-5-25-13-15)7-6-27-8-10-29-11-9-27/h1-5,12-13H,6-11,14H2,(H,26,30) |
| InChIKey | PYNBGXGLTDXWCF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|