C20H25FN4OS — CID 4319541
3-(2-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4319541) has the molecular formula C20H25FN4OS and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4319541 |
| Molecular Formula | C20H25FN4OS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-(2-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)N(CCCN1CCOCC1)Cc1cccnc1 |
| InChI | InChI=1S/C20H25FN4OS/c21-18-6-1-2-7-19(18)23-20(27)25(16-17-5-3-8-22-15-17)10-4-9-24-11-13-26-14-12-24/h1-3,5-8,15H,4,9-14,16H2,(H,23,27) |
| InChIKey | SYZPTVIRBMHHGV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|