C19H22Cl2N4OS — CID 17371072
3-(2,3-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 17371072) has the molecular formula C19H22Cl2N4OS and a molecular weight of 425.39 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17371072 |
| Molecular Formula | C19H22Cl2N4OS |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-(2-morpholin-4-ylethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(Nc1cccc(Cl)c1Cl)N(CCN1CCOCC1)Cc1cccnc1 |
| InChI | InChI=1S/C19H22Cl2N4OS/c20-16-4-1-5-17(18(16)21)23-19(27)25(14-15-3-2-6-22-13-15)8-7-24-9-11-26-12-10-24/h1-6,13H,7-12,14H2,(H,23,27) |
| InChIKey | NHWXDZUWVOQRGB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|