C22H22ClN3S — CID 4089369
1-[(2-chlorophenyl)methyl]-3-(2-ethylphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4089369) has the molecular formula C22H22ClN3S and a molecular weight of 395.96 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(2-ethylphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(2-ethylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4089369 |
| Molecular Formula | C22H22ClN3S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(2-ethylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCc1ccccc1NC(=S)N(Cc1cccnc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C22H22ClN3S/c1-2-18-9-4-6-12-21(18)25-22(27)26(15-17-8-7-13-24-14-17)16-19-10-3-5-11-20(19)23/h3-14H,2,15-16H2,1H3,(H,25,27) |
| InChIKey | AFTZFLIKAKBXDA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|