C21H17F4N3S — CID 17388204
1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 17388204) has the molecular formula C21H17F4N3S and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17388204 |
| Molecular Formula | C21H17F4N3S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1cccc(CN(Cc2cccnc2)C(=S)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F4N3S/c22-17-7-3-5-15(11-17)13-28(14-16-6-4-10-26-12-16)20(29)27-19-9-2-1-8-18(19)21(23,24)25/h1-12H,13-14H2,(H,27,29) |
| InChIKey | PDWYJAQAOIRVTK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|