C21H20ClN3S — CID 17379399
3-(2-chlorophenyl)-1-[(3-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 17379399) has the molecular formula C21H20ClN3S and a molecular weight of 381.93 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-[(3-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2-chlorophenyl)-1-[(3-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17379399 |
| Molecular Formula | C21H20ClN3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-(2-chlorophenyl)-1-[(3-methylphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cccc(CN(Cc2cccnc2)C(=S)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H20ClN3S/c1-16-6-4-7-17(12-16)14-25(15-18-8-5-11-23-13-18)21(26)24-20-10-3-2-9-19(20)22/h2-13H,14-15H2,1H3,(H,24,26) |
| InChIKey | OVYKNZXKZDZYBS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|