C15H17N3S — CID 8683425
1-methyl-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 8683425) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-methyl-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-methyl-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8683425 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-methyl-3-(3-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(C)Cc2cccnc2)c1 |
| InChI | InChI=1S/C15H17N3S/c1-12-5-3-7-14(9-12)17-15(19)18(2)11-13-6-4-8-16-10-13/h3-10H,11H2,1-2H3,(H,17,19) |
| InChIKey | HKQLMVPELUVLLQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|