C15H18N2S2 — CID 9214527
1-methyl-3-(3-methylphenyl)-1-[(3-methylthiophen-2-yl)methyl]thiourea (PubChem CID 9214527) has the molecular formula C15H18N2S2 and a molecular weight of 290.46 g/mol. Its IUPAC name is 1-methyl-3-(3-methylphenyl)-1-[(3-methylthiophen-2-yl)methyl]thiourea.
| Compound Name | 1-methyl-3-(3-methylphenyl)-1-[(3-methylthiophen-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 9214527 |
| Molecular Formula | C15H18N2S2 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-methyl-3-(3-methylphenyl)-1-[(3-methylthiophen-2-yl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(C)Cc2sccc2C)c1 |
| InChI | InChI=1S/C15H18N2S2/c1-11-5-4-6-13(9-11)16-15(18)17(3)10-14-12(2)7-8-19-14/h4-9H,10H2,1-3H3,(H,16,18) |
| InChIKey | CKVWCMHTOIWQQX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|