C9H14N2OS — CID 115169307
1,3-dimethyl-1-[(3-methylthiophen-2-yl)methyl]urea (PubChem CID 115169307) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 1,3-dimethyl-1-[(3-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1,3-dimethyl-1-[(3-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 115169307 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1,3-dimethyl-1-[(3-methylthiophen-2-yl)methyl]urea |
| SMILES | CNC(=O)N(C)Cc1sccc1C |
| InChI | InChI=1S/C9H14N2OS/c1-7-4-5-13-8(7)6-11(3)9(12)10-2/h4-5H,6H2,1-3H3,(H,10,12) |
| InChIKey | ZMQNICHWLIBCBF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |