C10H15NOS2 — CID 115167982
N-methyl-N-[(3-methylthiophen-2-yl)methyl]-3-sulfanylpropanamide (PubChem CID 115167982) has the molecular formula C10H15NOS2 and a molecular weight of 229.37 g/mol. Its IUPAC name is N-methyl-N-[(3-methylthiophen-2-yl)methyl]-3-sulfanylpropanamide.
| Compound Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 115167982 |
| Molecular Formula | C10H15NOS2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-3-sulfanylpropanamide |
| SMILES | Cc1ccsc1CN(C)C(=O)CCS |
| InChI | InChI=1S/C10H15NOS2/c1-8-4-6-14-9(8)7-11(2)10(12)3-5-13/h4,6,13H,3,5,7H2,1-2H3 |
| InChIKey | XFNBAXDANOTBPO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|