C14H23ClN2OS — CID 119689284
N-methyl-N-[(3-methylthiophen-2-yl)methyl]-2-piperidin-4-ylacetamide;hydrochloride (PubChem CID 119689284) has the molecular formula C14H23ClN2OS and a molecular weight of 302.87 g/mol. Its IUPAC name is N-methyl-N-[(3-methylthiophen-2-yl)methyl]-2-piperidin-4-ylacetamide;hydrochloride.
| Compound Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-2-piperidin-4-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119689284 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-methyl-N-[(3-methylthiophen-2-yl)methyl]-2-piperidin-4-ylacetamide;hydrochloride |
| SMILES | Cc1ccsc1CN(C)C(=O)CC1CCNCC1.Cl |
| InChI | InChI=1S/C14H22N2OS.ClH/c1-11-5-8-18-13(11)10-16(2)14(17)9-12-3-6-15-7-4-12;/h5,8,12,15H,3-4,6-7,9-10H2,1-2H3;1H |
| InChIKey | WKEBENVRQGLACR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |