C10H15NO2S — CID 115139250
3-hydroxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide (PubChem CID 115139250) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-hydroxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3-hydroxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 115139250 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-hydroxy-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
| SMILES | Cc1ccsc1CN(C)C(=O)CCO |
| InChI | InChI=1S/C10H15NO2S/c1-8-4-6-14-9(8)7-11(2)10(13)3-5-12/h4,6,12H,3,5,7H2,1-2H3 |
| InChIKey | LWQGXBQZHBCEFC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |