C16H18ClNO3S2 — CID 9020428
3-(4-chlorophenyl)sulfonyl-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide (PubChem CID 9020428) has the molecular formula C16H18ClNO3S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 9020428 |
| Molecular Formula | C16H18ClNO3S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-methyl-N-[(3-methylthiophen-2-yl)methyl]propanamide |
| SMILES | Cc1ccsc1CN(C)C(=O)CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO3S2/c1-12-7-9-22-15(12)11-18(2)16(19)8-10-23(20,21)14-5-3-13(17)4-6-14/h3-7,9H,8,10-11H2,1-2H3 |
| InChIKey | LMYFNMAMHAESQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |