C25H24N4S — CID 9231683
1-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methyl-3-(3-methylphenyl)thiourea (PubChem CID 9231683) has the molecular formula C25H24N4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methyl-3-(3-methylphenyl)thiourea.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methyl-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 9231683 |
| Molecular Formula | C25H24N4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-1-methyl-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N4S/c1-19-10-9-13-22(16-19)26-25(30)28(2)17-21-18-29(23-14-7-4-8-15-23)27-24(21)20-11-5-3-6-12-20/h3-16,18H,17H2,1-2H3,(H,26,30) |
| InChIKey | PISFDGLDVMRNFX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|