C23H18Cl2N4S — CID 19325026
1-(3,4-dichlorophenyl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea (PubChem CID 19325026) has the molecular formula C23H18Cl2N4S and a molecular weight of 453.40 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19325026 |
| Molecular Formula | C23H18Cl2N4S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea |
| SMILES | S=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N4S/c24-20-12-11-18(13-21(20)25)27-23(30)26-14-17-15-29(19-9-5-2-6-10-19)28-22(17)16-7-3-1-4-8-16/h1-13,15H,14H2,(H2,26,27,30) |
| InChIKey | KCBZABMAAPRVGJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|