C29H26Cl2N6S — CID 19325036
1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea (PubChem CID 19325036) has the molecular formula C29H26Cl2N6S and a molecular weight of 561.54 g/mol. Its IUPAC name is 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19325036 |
| Molecular Formula | C29H26Cl2N6S |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 1-[1-[(3,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[(1,3-diphenylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)c(Cl)c2)c(C)c1NC(=S)NCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H26Cl2N6S/c1-19-27(20(2)36(34-19)17-21-13-14-25(30)26(31)15-21)33-29(38)32-16-23-18-37(24-11-7-4-8-12-24)35-28(23)22-9-5-3-6-10-22/h3-15,18H,16-17H2,1-2H3,(H2,32,33,38) |
| InChIKey | OQKZXEREHIXBGK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|