C24H20ClN3OS — CID 19288805
2-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylsulfanylbenzamide (PubChem CID 19288805) has the molecular formula C24H20ClN3OS and a molecular weight of 433.96 g/mol. Its IUPAC name is 2-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 19288805 |
| Molecular Formula | C24H20ClN3OS |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-chloro-N-[(1,3-diphenylpyrazol-4-yl)methyl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H20ClN3OS/c1-30-20-12-13-22(25)21(14-20)24(29)26-15-18-16-28(19-10-6-3-7-11-19)27-23(18)17-8-4-2-5-9-17/h2-14,16H,15H2,1H3,(H,26,29) |
| InChIKey | MNWDFXBRHATGTO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |