C22H21N5O — CID 19281007
N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-ethylpyrazole-4-carboxamide (PubChem CID 19281007) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-ethylpyrazole-4-carboxamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281007 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-ethylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C22H21N5O/c1-2-26-15-19(14-24-26)22(28)23-13-18-16-27(20-11-7-4-8-12-20)25-21(18)17-9-5-3-6-10-17/h3-12,14-16H,2,13H2,1H3,(H,23,28) |
| InChIKey | JFVNGFAHBCJSQJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |