C31H22N4O3 — CID 19288807
3-(1,3-dioxoisoindol-2-yl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide (PubChem CID 19288807) has the molecular formula C31H22N4O3 and a molecular weight of 498.54 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19288807 |
| Molecular Formula | C31H22N4O3 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C31H22N4O3/c36-29(22-12-9-15-25(18-22)35-30(37)26-16-7-8-17-27(26)31(35)38)32-19-23-20-34(24-13-5-2-6-14-24)33-28(23)21-10-3-1-4-11-21/h1-18,20H,19H2,(H,32,36) |
| InChIKey | SQGMVVKQUVEBAP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|