C32H29N3O2 — CID 19290281
3-[(2,4-dimethylphenoxy)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide (PubChem CID 19290281) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenoxy)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-[(2,4-dimethylphenoxy)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 19290281 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 3-[(2,4-dimethylphenoxy)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cc1ccc(OCc2cccc(C(=O)NCc3cn(-c4ccccc4)nc3-c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C32H29N3O2/c1-23-16-17-30(24(2)18-23)37-22-25-10-9-13-27(19-25)32(36)33-20-28-21-35(29-14-7-4-8-15-29)34-31(28)26-11-5-3-6-12-26/h3-19,21H,20,22H2,1-2H3,(H,33,36) |
| InChIKey | JSIVSQCLYUFSSE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |