C25H23N3O2 — CID 24548704
N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(methoxymethyl)benzamide (PubChem CID 24548704) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(methoxymethyl)benzamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 24548704 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(methoxymethyl)benzamide |
| SMILES | COCc1cccc(C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H23N3O2/c1-30-18-19-9-8-12-21(15-19)25(29)26-16-22-17-28(23-13-6-3-7-14-23)27-24(22)20-10-4-2-5-11-20/h2-15,17H,16,18H2,1H3,(H,26,29) |
| InChIKey | RBKZKVBQPWUIMG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |