C24H22N4O3S — CID 42116246
N-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(methanesulfonamido)benzamide (PubChem CID 42116246) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 42116246 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-32(30,31)27-21-14-12-19(13-15-21)24(29)25-16-20-17-28(22-10-6-3-7-11-22)26-23(20)18-8-4-2-5-9-18/h2-15,17,27H,16H2,1H3,(H,25,29) |
| InChIKey | WJNRJMBQPALURQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |