C24H21N3O4S — CID 27270686
(1,3-diphenylpyrazol-4-yl)methyl 2-(methanesulfonamido)benzoate (PubChem CID 27270686) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 2-(methanesulfonamido)benzoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 27270686 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 2-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)OCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-32(29,30)26-22-15-9-8-14-21(22)24(28)31-17-19-16-27(20-12-6-3-7-13-20)25-23(19)18-10-4-2-5-11-18/h2-16,26H,17H2,1H3 |
| InChIKey | VPLWYXFLNJDHBS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |