(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate

C27H20N2O2 — CID 7697736

IUPAC(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate
SMILESO=C(OCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc2ccccc2c1
InChIInChI=1S/C27H20N2O2/c30-27(23-16-15-20-9-7-8-12-22(20)17-23)31-19-24-18-29(25-13-5-2-6-14-25)28-26(24)21-10-3-1-4-11-21/h1-18H,19H2
InChIKeyDVLNIZFQPBZANA-UHFFFAOYSA-N
MW404.47 g/mol
LogP6.05
Rot. Bonds5

About (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate

(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate (PubChem CID 7697736) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate.

Molecular Properties

Compound Name(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate
PubChem CID7697736
Molecular FormulaC27H20N2O2
Molecular Weight404.47 g/mol
Exact Mass404.15
IUPAC Name(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate
SMILESO=C(OCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc2ccccc2c1
InChIInChI=1S/C27H20N2O2/c30-27(23-16-15-20-9-7-8-12-22(20)17-23)31-19-24-18-29(25-13-5-2-6-14-25)28-26(24)21-10-3-1-4-11-21/h1-18H,19H2
InChIKeyDVLNIZFQPBZANA-UHFFFAOYSA-N
XLogP6.05
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500404.47
LogP ≤ 56.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate?
The IUPAC name of (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate (CID 7697736) is (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate.
What is the SMILES notation for (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate?
The canonical SMILES for (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate is O=C(OCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc2ccccc2c1.
What is the InChIKey of (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate?
The InChIKey is DVLNIZFQPBZANA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N2O2/c30-27(23-16-15-20-9-7-8-12-22(20)17-23)31-19-24-18-29(25-13-5-2-6-14-25)28-26(24)21-10-3-1-4-11-21/h1-18H,19H2.
What are the key properties of (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate?
(1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate has a molecular weight of 404.47 g/mol, XLogP of 6.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-diphenylpyrazol-4-yl)methyl naphthalene-2-carboxylate is sourced from PubChem (CID 7697736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).