C25H23N3O4S — CID 2093367
(1,3-diphenylpyrazol-4-yl)methyl 3-(dimethylsulfamoyl)benzoate (PubChem CID 2093367) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 3-(dimethylsulfamoyl)benzoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2093367 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)OCc2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H23N3O4S/c1-27(2)33(30,31)23-15-9-12-20(16-23)25(29)32-18-21-17-28(22-13-7-4-8-14-22)26-24(21)19-10-5-3-6-11-19/h3-17H,18H2,1-2H3 |
| InChIKey | KTXDDYIYVSNNCR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |