C24H22N4O3S — CID 46644099
4-[(1,3-diphenylpyrazol-4-yl)methyl-methylsulfamoyl]benzamide (PubChem CID 46644099) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[(1,3-diphenylpyrazol-4-yl)methyl-methylsulfamoyl]benzamide.
| Compound Name | 4-[(1,3-diphenylpyrazol-4-yl)methyl-methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 46644099 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-[(1,3-diphenylpyrazol-4-yl)methyl-methylsulfamoyl]benzamide |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccccc1)S(=O)(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-27(32(30,31)22-14-12-19(13-15-22)24(25)29)16-20-17-28(21-10-6-3-7-11-21)26-23(20)18-8-4-2-5-9-18/h2-15,17H,16H2,1H3,(H2,25,29) |
| InChIKey | BRQYLLNTVFBDTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |