C23H21N3O2S — CID 42348958
N-benzyl-N-methyl-1,3-diphenylpyrazole-4-sulfonamide (PubChem CID 42348958) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-benzyl-N-methyl-1,3-diphenylpyrazole-4-sulfonamide.
| Compound Name | N-benzyl-N-methyl-1,3-diphenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42348958 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-benzyl-N-methyl-1,3-diphenylpyrazole-4-sulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H21N3O2S/c1-25(17-19-11-5-2-6-12-19)29(27,28)22-18-26(21-15-9-4-10-16-21)24-23(22)20-13-7-3-8-14-20/h2-16,18H,17H2,1H3 |
| InChIKey | SZQZHQCRVKEHCQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |