C20H19NO4S — CID 175262057
N-benzyl-2,4-dihydroxy-N-methyl-5-phenylbenzenesulfonamide (PubChem CID 175262057) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-benzyl-2,4-dihydroxy-N-methyl-5-phenylbenzenesulfonamide.
| Compound Name | N-benzyl-2,4-dihydroxy-N-methyl-5-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 175262057 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-benzyl-2,4-dihydroxy-N-methyl-5-phenylbenzenesulfonamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1cc(-c2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C20H19NO4S/c1-21(14-15-8-4-2-5-9-15)26(24,25)20-12-17(18(22)13-19(20)23)16-10-6-3-7-11-16/h2-13,22-23H,14H2,1H3 |
| InChIKey | ATGKOMGFXKCUEB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |