C21H18F3NO3S — CID 68737669
N-[[3-[2-hydroxy-5-(trifluoromethyl)phenyl]phenyl]methyl]-N-methylbenzenesulfonamide (PubChem CID 68737669) has the molecular formula C21H18F3NO3S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[[3-[2-hydroxy-5-(trifluoromethyl)phenyl]phenyl]methyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[[3-[2-hydroxy-5-(trifluoromethyl)phenyl]phenyl]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 68737669 |
| Molecular Formula | C21H18F3NO3S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[[3-[2-hydroxy-5-(trifluoromethyl)phenyl]phenyl]methyl]-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1cccc(-c2cc(C(F)(F)F)ccc2O)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18F3NO3S/c1-25(29(27,28)18-8-3-2-4-9-18)14-15-6-5-7-16(12-15)19-13-17(21(22,23)24)10-11-20(19)26/h2-13,26H,14H2,1H3 |
| InChIKey | GIQYNQMIKVIFLD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |