C15H11F3O4S — CID 172648599
2-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzoic acid (PubChem CID 172648599) has the molecular formula C15H11F3O4S and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 172648599 |
| Molecular Formula | C15H11F3O4S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-(3-methylsulfonylphenyl)-4-(trifluoromethyl)benzoic acid |
| SMILES | CS(=O)(=O)c1cccc(-c2cc(C(F)(F)F)ccc2C(=O)O)c1 |
| InChI | InChI=1S/C15H11F3O4S/c1-23(21,22)11-4-2-3-9(7-11)13-8-10(15(16,17)18)5-6-12(13)14(19)20/h2-8H,1H3,(H,19,20) |
| InChIKey | OUPVTOJXHQYUHD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |