C21H15F3O3 — CID 172648598
2-(3-phenylmethoxyphenyl)-4-(trifluoromethyl)benzoic acid (PubChem CID 172648598) has the molecular formula C21H15F3O3 and a molecular weight of 372.34 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(3-phenylmethoxyphenyl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 172648598 |
| Molecular Formula | C21H15F3O3 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1-c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H15F3O3/c22-21(23,24)16-9-10-18(20(25)26)19(12-16)15-7-4-8-17(11-15)27-13-14-5-2-1-3-6-14/h1-12H,13H2,(H,25,26) |
| InChIKey | VDKXIAHOLXITSK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |