C9H7F3O4S — CID 26598188
2-methylsulfonyl-5-(trifluoromethyl)benzoic acid (PubChem CID 26598188) has the molecular formula C9H7F3O4S and a molecular weight of 268.21 g/mol. Its IUPAC name is 2-methylsulfonyl-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-methylsulfonyl-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 26598188 |
| Molecular Formula | C9H7F3O4S |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 2-methylsulfonyl-5-(trifluoromethyl)benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C9H7F3O4S/c1-17(15,16)7-3-2-5(9(10,11)12)4-6(7)8(13)14/h2-4H,1H3,(H,13,14) |
| InChIKey | CBZHRYXIYMQKCF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |