C12H17F3NO7S2+ — CID 87200213
(3-carboxy-4-methylsulfonylphenyl)-trimethylazanium;trifluoromethanesulfonic acid (PubChem CID 87200213) has the molecular formula C12H17F3NO7S2+ and a molecular weight of 408.40 g/mol. Its IUPAC name is (3-carboxy-4-methylsulfonylphenyl)-trimethylazanium;trifluoromethanesulfonic acid.
| Compound Name | (3-carboxy-4-methylsulfonylphenyl)-trimethylazanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87200213 |
| Molecular Formula | C12H17F3NO7S2+ |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (3-carboxy-4-methylsulfonylphenyl)-trimethylazanium;trifluoromethanesulfonic acid |
| SMILES | C[N+](C)(C)c1ccc(S(C)(=O)=O)c(C(=O)O)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C11H15NO4S.CHF3O3S/c1-12(2,3)8-5-6-10(17(4,15)16)9(7-8)11(13)14;2-1(3,4)8(5,6)7/h5-7H,1-4H3;(H,5,6,7)/p+1 |
| InChIKey | UXOAZLQHWDPZGD-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|