C12H13F3N2O5S — CID 141202988
(4-carboxy-3-cyanophenyl)-trimethylazanium;trifluoromethanesulfonate (PubChem CID 141202988) has the molecular formula C12H13F3N2O5S and a molecular weight of 354.31 g/mol. Its IUPAC name is (4-carboxy-3-cyanophenyl)-trimethylazanium;trifluoromethanesulfonate.
| Compound Name | (4-carboxy-3-cyanophenyl)-trimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141202988 |
| Molecular Formula | C12H13F3N2O5S |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (4-carboxy-3-cyanophenyl)-trimethylazanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)(C)c1ccc(C(=O)O)c(C#N)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H12N2O2.CHF3O3S/c1-13(2,3)9-4-5-10(11(14)15)8(6-9)7-12;2-1(3,4)8(5,6)7/h4-6H,1-3H3;(H,5,6,7) |
| InChIKey | XXLRCYCDSGPXRO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|