C10H3F6NO2 — CID 118815279
4-cyano-2,3-bis(trifluoromethyl)benzoic acid (PubChem CID 118815279) has the molecular formula C10H3F6NO2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 4-cyano-2,3-bis(trifluoromethyl)benzoic acid.
| Compound Name | 4-cyano-2,3-bis(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 118815279 |
| Molecular Formula | C10H3F6NO2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 4-cyano-2,3-bis(trifluoromethyl)benzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H3F6NO2/c11-9(12,13)6-4(3-17)1-2-5(8(18)19)7(6)10(14,15)16/h1-2H,(H,18,19) |
| InChIKey | CUIFFWIDSMMQHS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |