C11H8F6O2 — CID 119023089
4-ethyl-2,3-bis(trifluoromethyl)benzoic acid (PubChem CID 119023089) has the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid.
| Compound Name | 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 119023089 |
| Molecular Formula | C11H8F6O2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11H8F6O2/c1-2-5-3-4-6(9(18)19)8(11(15,16)17)7(5)10(12,13)14/h3-4H,2H2,1H3,(H,18,19) |
| InChIKey | SAJQJUZOZKPRTA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |