4-ethyl-2,3-bis(trifluoromethyl)benzoic acid

C11H8F6O2 — CID 119023089

IUPAC4-ethyl-2,3-bis(trifluoromethyl)benzoic acid
SMILESCCc1ccc(C(=O)O)c(C(F)(F)F)c1C(F)(F)F
InChIInChI=1S/C11H8F6O2/c1-2-5-3-4-6(9(18)19)8(11(15,16)17)7(5)10(12,13)14/h3-4H,2H2,1H3,(H,18,19)
InChIKeySAJQJUZOZKPRTA-UHFFFAOYSA-N
MW286.17 g/mol
LogP3.98
Rot. Bonds2

About 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid

4-ethyl-2,3-bis(trifluoromethyl)benzoic acid (PubChem CID 119023089) has the molecular formula C11H8F6O2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid.

Molecular Properties

Compound Name4-ethyl-2,3-bis(trifluoromethyl)benzoic acid
PubChem CID119023089
Molecular FormulaC11H8F6O2
Molecular Weight286.17 g/mol
Exact Mass286.04
IUPAC Name4-ethyl-2,3-bis(trifluoromethyl)benzoic acid
SMILESCCc1ccc(C(=O)O)c(C(F)(F)F)c1C(F)(F)F
InChIInChI=1S/C11H8F6O2/c1-2-5-3-4-6(9(18)19)8(11(15,16)17)7(5)10(12,13)14/h3-4H,2H2,1H3,(H,18,19)
InChIKeySAJQJUZOZKPRTA-UHFFFAOYSA-N
XLogP3.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.17
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid?
The IUPAC name of 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid (CID 119023089) is 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid.
What is the SMILES notation for 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid?
The canonical SMILES for 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid is CCc1ccc(C(=O)O)c(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid?
The InChIKey is SAJQJUZOZKPRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F6O2/c1-2-5-3-4-6(9(18)19)8(11(15,16)17)7(5)10(12,13)14/h3-4H,2H2,1H3,(H,18,19).
What are the key properties of 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid?
4-ethyl-2,3-bis(trifluoromethyl)benzoic acid has a molecular weight of 286.17 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3-bis(trifluoromethyl)benzoic acid is sourced from PubChem (CID 119023089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).