C11H14F4NO5S+ — CID 87200240
(4-carboxy-3-fluorophenyl)-trimethylazanium;trifluoromethanesulfonic acid (PubChem CID 87200240) has the molecular formula C11H14F4NO5S+ and a molecular weight of 348.29 g/mol. Its IUPAC name is (4-carboxy-3-fluorophenyl)-trimethylazanium;trifluoromethanesulfonic acid.
| Compound Name | (4-carboxy-3-fluorophenyl)-trimethylazanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87200240 |
| Molecular Formula | C11H14F4NO5S+ |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (4-carboxy-3-fluorophenyl)-trimethylazanium;trifluoromethanesulfonic acid |
| SMILES | C[N+](C)(C)c1ccc(C(=O)O)c(F)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H12FNO2.CHF3O3S/c1-12(2,3)7-4-5-8(10(13)14)9(11)6-7;2-1(3,4)8(5,6)7/h4-6H,1-3H3;(H,5,6,7)/p+1 |
| InChIKey | XUXTXSVLPIWZRS-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|